C23H41FO — CID 19695360
1-[(E)-6-fluorohex-3-enyl]-4-[2-[4-(1-methoxyethyl)cyclohexyl]ethyl]cyclohexane (PubChem CID 19695360) has the molecular formula C23H41FO and a molecular weight of 352.58 g/mol. Its IUPAC name is 1-[(E)-6-fluorohex-3-enyl]-4-[2-[4-(1-methoxyethyl)cyclohexyl]ethyl]cyclohexane.
| Compound Name | 1-[(E)-6-fluorohex-3-enyl]-4-[2-[4-(1-methoxyethyl)cyclohexyl]ethyl]cyclohexane |
|---|---|
| PubChem CID | 19695360 |
| Molecular Formula | C23H41FO |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 1-[(E)-6-fluorohex-3-enyl]-4-[2-[4-(1-methoxyethyl)cyclohexyl]ethyl]cyclohexane |
| SMILES | COC(C)C1CCC(CCC2CCC(CC/C=C/CCF)CC2)CC1 |
| InChI | InChI=1S/C23H41FO/c1-19(25-2)23-16-14-22(15-17-23)13-12-21-10-8-20(9-11-21)7-5-3-4-6-18-24/h3-4,19-23H,5-18H2,1-2H3/b4-3+ |
| InChIKey | BPQWPARBWFLHSQ-ONEGZZNKSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|