C19H27F3O — CID 18657552
1-ethyl-4-[(E)-4-[4-(trifluoromethoxy)cyclohexyl]but-1-en-3-ynyl]cyclohexane (PubChem CID 18657552) has the molecular formula C19H27F3O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-4-[4-(trifluoromethoxy)cyclohexyl]but-1-en-3-ynyl]cyclohexane.
| Compound Name | 1-ethyl-4-[(E)-4-[4-(trifluoromethoxy)cyclohexyl]but-1-en-3-ynyl]cyclohexane |
|---|---|
| PubChem CID | 18657552 |
| Molecular Formula | C19H27F3O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-ethyl-4-[(E)-4-[4-(trifluoromethoxy)cyclohexyl]but-1-en-3-ynyl]cyclohexane |
| SMILES | CCC1CCC(/C=C/C#CC2CCC(OC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C19H27F3O/c1-2-15-7-9-16(10-8-15)5-3-4-6-17-11-13-18(14-12-17)23-19(20,21)22/h3,5,15-18H,2,7-14H2,1H3/b5-3+ |
| InChIKey | IPIXMWMPXFUWOQ-HWKANZROSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|