C22H34F2O — CID 18657538
1-(difluoromethoxy)-4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexane (PubChem CID 18657538) has the molecular formula C22H34F2O and a molecular weight of 352.51 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexane.
| Compound Name | 1-(difluoromethoxy)-4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexane |
|---|---|
| PubChem CID | 18657538 |
| Molecular Formula | C22H34F2O |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 1-(difluoromethoxy)-4-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]cyclohexane |
| SMILES | CCCCCC1CCC(/C=C/C#CC2CCC(OC(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H34F2O/c1-2-3-4-7-18-10-12-19(13-11-18)8-5-6-9-20-14-16-21(17-15-20)25-22(23)24/h5,8,18-22H,2-4,7,10-17H2,1H3/b8-5+ |
| InChIKey | QDVHSFJITXCXTH-VMPITWQZSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|