C29H48F2O — CID 20599715
2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane (PubChem CID 20599715) has the molecular formula C29H48F2O and a molecular weight of 450.70 g/mol. Its IUPAC name is 2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane.
| Compound Name | 2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane |
|---|---|
| PubChem CID | 20599715 |
| Molecular Formula | C29H48F2O |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]butyl]oxane |
| SMILES | C/C=C/C1CCC(CCCCC2CCC(C3CCC(CCCC=C(F)F)CC3)OC2)CC1 |
| InChI | InChI=1S/C29H48F2O/c1-2-7-23-12-14-24(15-13-23)8-3-4-10-26-18-21-28(32-22-26)27-19-16-25(17-20-27)9-5-6-11-29(30)31/h2,7,11,23-28H,3-6,8-10,12-22H2,1H3/b7-2+ |
| InChIKey | MNOLEHOBZBLILB-FARCUNLSSA-N |
| XLogP | 9.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|