C27H47FO — CID 19695318
1-[4-[(E)-5-fluorohept-1-enyl]cyclohexyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane (PubChem CID 19695318) has the molecular formula C27H47FO and a molecular weight of 406.67 g/mol. Its IUPAC name is 1-[4-[(E)-5-fluorohept-1-enyl]cyclohexyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane.
| Compound Name | 1-[4-[(E)-5-fluorohept-1-enyl]cyclohexyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 19695318 |
| Molecular Formula | C27H47FO |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | 1-[4-[(E)-5-fluorohept-1-enyl]cyclohexyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane |
| SMILES | CCC(F)CC/C=C/C1CCC(C2CCC(C3CCC(COC)CC3)CC2)CC1 |
| InChI | InChI=1S/C27H47FO/c1-3-27(28)7-5-4-6-21-8-12-23(13-9-21)25-16-18-26(19-17-25)24-14-10-22(11-15-24)20-29-2/h4,6,21-27H,3,5,7-20H2,1-2H3/b6-4+ |
| InChIKey | CXJKYKVBQZUNSJ-GQCTYLIASA-N |
| XLogP | 8.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|