C18H31FO — CID 19798821
1-[(E)-4-fluorobut-3-enyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane (PubChem CID 19798821) has the molecular formula C18H31FO and a molecular weight of 282.44 g/mol. Its IUPAC name is 1-[(E)-4-fluorobut-3-enyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane.
| Compound Name | 1-[(E)-4-fluorobut-3-enyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 19798821 |
| Molecular Formula | C18H31FO |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 1-[(E)-4-fluorobut-3-enyl]-4-[4-(methoxymethyl)cyclohexyl]cyclohexane |
| SMILES | COCC1CCC(C2CCC(CC/C=C/F)CC2)CC1 |
| InChI | InChI=1S/C18H31FO/c1-20-14-16-7-11-18(12-8-16)17-9-5-15(6-10-17)4-2-3-13-19/h3,13,15-18H,2,4-12,14H2,1H3/b13-3+ |
| InChIKey | BGGOVIAVFNEDOT-QLKAYGNNSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |