C25H38F2O — CID 20599589
2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-[(1E)-hexa-1,5-dienyl]oxane (PubChem CID 20599589) has the molecular formula C25H38F2O and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-[(1E)-hexa-1,5-dienyl]oxane.
| Compound Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-[(1E)-hexa-1,5-dienyl]oxane |
|---|---|
| PubChem CID | 20599589 |
| Molecular Formula | C25H38F2O |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-[(1E)-hexa-1,5-dienyl]oxane |
| SMILES | C=CCC/C=C/C1CCC(C2CCC(C3CCC(C=C(F)F)CC3)CC2)OC1 |
| InChI | InChI=1S/C25H38F2O/c1-2-3-4-5-6-20-9-16-24(28-18-20)23-14-12-22(13-15-23)21-10-7-19(8-11-21)17-25(26)27/h2,5-6,17,19-24H,1,3-4,7-16,18H2/b6-5+ |
| InChIKey | WUISUHANTQPDAC-AATRIKPKSA-N |
| XLogP | 7.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|