C27H42F2O — CID 20599526
2-[(E)-2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]ethenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]oxane (PubChem CID 20599526) has the molecular formula C27H42F2O and a molecular weight of 420.63 g/mol. Its IUPAC name is 2-[(E)-2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]ethenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]oxane.
| Compound Name | 2-[(E)-2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]ethenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599526 |
| Molecular Formula | C27H42F2O |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | 2-[(E)-2-[4-(5,5-difluoropent-4-enyl)cyclohexyl]ethenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]oxane |
| SMILES | C/C=C/C1CCC(C2CCC(/C=C/C3CCC(CCCC=C(F)F)CC3)OC2)CC1 |
| InChI | InChI=1S/C27H42F2O/c1-2-5-21-12-15-24(16-13-21)25-17-19-26(30-20-25)18-14-23-10-8-22(9-11-23)6-3-4-7-27(28)29/h2,5,7,14,18,21-26H,3-4,6,8-13,15-17,19-20H2,1H3/b5-2+,18-14+ |
| InChIKey | OMAVNMGZRIDYQT-AXTNOSINSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|