C21H34F2O — CID 20599491
2-[(E)-2-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]ethenyl]-5-pentyloxane (PubChem CID 20599491) has the molecular formula C21H34F2O and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-[(E)-2-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]ethenyl]-5-pentyloxane.
| Compound Name | 2-[(E)-2-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]ethenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 20599491 |
| Molecular Formula | C21H34F2O |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-[(E)-2-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]ethenyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(/C=C/C2CCC(CC=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C21H34F2O/c1-2-3-4-5-19-11-14-20(24-16-19)13-10-17-6-8-18(9-7-17)12-15-21(22)23/h10,13,15,17-20H,2-9,11-12,14,16H2,1H3/b13-10+ |
| InChIKey | VAGGDRXSGYHXED-JLHYYAGUSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|