C10H13N3O2 — CID 140518083
3-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridine-5-carboxamide (PubChem CID 140518083) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridine-5-carboxamide.
| Compound Name | 3-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 140518083 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridine-5-carboxamide |
| SMILES | NC(=O)C1=CNCC(N2CCCC2=O)=C1 |
| InChI | InChI=1S/C10H13N3O2/c11-10(15)7-4-8(6-12-5-7)13-3-1-2-9(13)14/h4-5,12H,1-3,6H2,(H2,11,15) |
| InChIKey | DBIHENPNEKTXPM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |