C10H9N9O — CID 140518111
4-[(5-pyridin-2-yltetrazol-1-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 140518111) has the molecular formula C10H9N9O and a molecular weight of 271.24 g/mol. Its IUPAC name is 4-[(5-pyridin-2-yltetrazol-1-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[(5-pyridin-2-yltetrazol-1-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 140518111 |
| Molecular Formula | C10H9N9O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[(5-pyridin-2-yltetrazol-1-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1nonc1Cn1nnnc1-c1ccccn1 |
| InChI | InChI=1S/C10H9N9O/c11-9(12)8-7(15-20-16-8)5-19-10(14-17-18-19)6-3-1-2-4-13-6/h1-4H,5H2,(H3,11,12) |
| InChIKey | QKBFTCBVDWECSR-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|