C26H26N8O5 — CID 140522121
[2-carbamimidoyl-5-[[(S)-[3-ethenyl-5-(2-hydroxyethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate (PubChem CID 140522121) has the molecular formula C26H26N8O5 and a molecular weight of 530.55 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(S)-[3-ethenyl-5-(2-hydroxyethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[(S)-[3-ethenyl-5-(2-hydroxyethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522121 |
| Molecular Formula | C26H26N8O5 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | [2-carbamimidoyl-5-[[(S)-[3-ethenyl-5-(2-hydroxyethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](c2cc(C=C)cc(OCCO)c2)c2nn(-c3ncccn3)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C26H26N8O5/c1-3-16-11-17(13-19(12-16)38-10-9-35)22(24-32-26(37)34(33-24)25-29-7-4-8-30-25)31-18-5-6-20(23(27)28)21(14-18)39-15(2)36/h3-8,11-14,22,31,35H,1,9-10H2,2H3,(H3,27,28)(H,32,33,37)/t22-/m0/s1 |
| InChIKey | MXXZREYVXIZWHK-QFIPXVFZSA-N |
| XLogP | 1.78 |
| TPSA | 194.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|