C26H23FN8O4 — CID 140522388
[2-carbamimidoyl-5-[[(S)-[3-ethynyl-5-(2-fluoroethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate (PubChem CID 140522388) has the molecular formula C26H23FN8O4 and a molecular weight of 530.52 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[(S)-[3-ethynyl-5-(2-fluoroethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[(S)-[3-ethynyl-5-(2-fluoroethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522388 |
| Molecular Formula | C26H23FN8O4 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [2-carbamimidoyl-5-[[(S)-[3-ethynyl-5-(2-fluoroethoxy)phenyl]-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](c2cc(C#C)cc(OCCF)c2)c2nn(-c3ncccn3)c(=O)[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C26H23FN8O4/c1-3-16-11-17(13-19(12-16)38-10-7-27)22(24-33-26(37)35(34-24)25-30-8-4-9-31-25)32-18-5-6-20(23(28)29)21(14-18)39-15(2)36/h1,4-6,8-9,11-14,22,32H,7,10H2,2H3,(H3,28,29)(H,33,34,37)/t22-/m0/s1 |
| InChIKey | VUQAWIKAYVPTBV-QFIPXVFZSA-N |
| XLogP | 2.09 |
| TPSA | 173.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|