C26H24F3N7O5 — CID 140522151
[2-carbamimidoyl-5-[[[2-fluoro-3-(2-fluoroethoxy)-5-methoxyphenyl]-[1-(3-fluoro-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate (PubChem CID 140522151) has the molecular formula C26H24F3N7O5 and a molecular weight of 571.52 g/mol. Its IUPAC name is [2-carbamimidoyl-5-[[[2-fluoro-3-(2-fluoroethoxy)-5-methoxyphenyl]-[1-(3-fluoro-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate.
| Compound Name | [2-carbamimidoyl-5-[[[2-fluoro-3-(2-fluoroethoxy)-5-methoxyphenyl]-[1-(3-fluoro-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 140522151 |
| Molecular Formula | C26H24F3N7O5 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | [2-carbamimidoyl-5-[[[2-fluoro-3-(2-fluoroethoxy)-5-methoxyphenyl]-[1-(3-fluoro-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]phenyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2nn(-c3ncccc3F)c(=O)[nH]2)c2cc(OC)cc(OCCF)c2F)cc1OC(C)=O |
| InChI | InChI=1S/C26H24F3N7O5/c1-13(37)41-19-10-14(5-6-16(19)23(30)31)33-22(17-11-15(39-2)12-20(21(17)29)40-9-7-27)24-34-26(38)36(35-24)25-18(28)4-3-8-32-25/h3-6,8,10-12,22,33H,7,9H2,1-2H3,(H3,30,31)(H,34,35,38) |
| InChIKey | CFEGZSFDQKTMFN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 170.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|