C23H42O7Si — CID 140522602
[(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(1R)-1-hydroxyethyl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 140522602) has the molecular formula C23H42O7Si and a molecular weight of 458.67 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(1R)-1-hydroxyethyl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(1R)-1-hydroxyethyl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 140522602 |
| Molecular Formula | C23H42O7Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7-hydroxy-2-[(1R)-1-hydroxyethyl]-3,7-dimethyl-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC[C@@](C)(O)[C@@H](OC(C)=O)/C=C/[C@H](C)[C@@H]([C@@H](C)O)OC(=O)C1 |
| InChI | InChI=1S/C23H42O7Si/c1-8-31(9-2,10-3)30-19-13-14-23(7,27)20(28-18(6)25)12-11-16(4)22(17(5)24)29-21(26)15-19/h11-12,16-17,19-20,22,24,27H,8-10,13-15H2,1-7H3/b12-11+/t16-,17+,19+,20-,22-,23+/m0/s1 |
| InChIKey | AQFVBTZRWBRUHO-TVOLXAQOSA-N |
| XLogP | 3.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|