C21H31N3O4S — CID 140524144
4-amino-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 140524144) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 4-amino-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 4-amino-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 140524144 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-amino-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | CC12CC[C@H](C1)C(C)(C)C2NC(=O)c1ccc(N)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H31N3O4S/c1-20(2)15-6-7-21(3,13-15)19(20)23-18(25)14-4-5-16(22)17(12-14)29(26,27)24-8-10-28-11-9-24/h4-5,12,15,19H,6-11,13,22H2,1-3H3,(H,23,25)/t15-,19?,21?/m1/s1 |
| InChIKey | UIHQLDOTTVNRSL-BSFYPJFYSA-N |
| XLogP | 2.23 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|