C25H39N3O5S — CID 140524136
4-(3-methoxypropylamino)-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 140524136) has the molecular formula C25H39N3O5S and a molecular weight of 493.67 g/mol. Its IUPAC name is 4-(3-methoxypropylamino)-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 4-(3-methoxypropylamino)-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 140524136 |
| Molecular Formula | C25H39N3O5S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 4-(3-methoxypropylamino)-3-morpholin-4-ylsulfonyl-N-[(4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | COCCCNc1ccc(C(=O)NC2C3(C)CC[C@H](C3)C2(C)C)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H39N3O5S/c1-24(2)19-8-9-25(3,17-19)23(24)27-22(29)18-6-7-20(26-10-5-13-32-4)21(16-18)34(30,31)28-11-14-33-15-12-28/h6-7,16,19,23,26H,5,8-15,17H2,1-4H3,(H,27,29)/t19-,23?,25?/m1/s1 |
| InChIKey | GRPOUGAMYUBSPP-KPSOWUDTSA-N |
| XLogP | 3.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|