C27H43N3O5S — CID 163779739
4-(3-methoxypropyl)-3-morpholin-4-ylsulfonyl-N'-[2-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]ethyl]benzohydrazide (PubChem CID 163779739) has the molecular formula C27H43N3O5S and a molecular weight of 521.72 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-3-morpholin-4-ylsulfonyl-N'-[2-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]ethyl]benzohydrazide.
| Compound Name | 4-(3-methoxypropyl)-3-morpholin-4-ylsulfonyl-N'-[2-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 163779739 |
| Molecular Formula | C27H43N3O5S |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 4-(3-methoxypropyl)-3-morpholin-4-ylsulfonyl-N'-[2-[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]ethyl]benzohydrazide |
| SMILES | COCCCc1ccc(C(=O)NNCCC2C(C)(C)[C@@H]3CC[C@@]2(C)C3)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H43N3O5S/c1-26(2)22-9-11-27(3,19-22)24(26)10-12-28-29-25(31)21-8-7-20(6-5-15-34-4)23(18-21)36(32,33)30-13-16-35-17-14-30/h7-8,18,22,24,28H,5-6,9-17,19H2,1-4H3,(H,29,31)/t22-,24?,27+/m1/s1 |
| InChIKey | MNPVPHBBQWFEBW-BPMXUHRXSA-N |
| XLogP | 3.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|