C12H16N2O2 — CID 140526183
2,6-diisocyanato-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 140526183) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2,6-diisocyanato-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2,6-diisocyanato-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 140526183 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2,6-diisocyanato-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC(N=C=O)CC2CC(N=C=O)CC12 |
| InChI | InChI=1S/C12H16N2O2/c1-8-2-10(13-6-15)3-9-4-11(14-7-16)5-12(8)9/h8-12H,2-5H2,1H3 |
| InChIKey | BJIBMSOBRSDDAN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|