C21H25N3O3 — CID 140527007
3-[[4-[N-(4-propylbenzoyl)carbamimidoyl]phenyl]methylamino]propanoic acid (PubChem CID 140527007) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[[4-[N-(4-propylbenzoyl)carbamimidoyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[N-(4-propylbenzoyl)carbamimidoyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 140527007 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[[4-[N-(4-propylbenzoyl)carbamimidoyl]phenyl]methylamino]propanoic acid |
| SMILES | [H]/N=C(\NC(=O)c1ccc(CCC)cc1)c1ccc(CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-3-15-4-10-18(11-5-15)21(27)24-20(22)17-8-6-16(7-9-17)14-23-13-12-19(25)26/h4-11,23H,2-3,12-14H2,1H3,(H,25,26)(H2,22,24,27) |
| InChIKey | HABXUWGEUCYMKK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|