C23H24ClN3O4 — CID 162334087
3-[[4-[N-[4-(furan-2-yl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid;hydrochloride (PubChem CID 162334087) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is 3-[[4-[N-[4-(furan-2-yl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid;hydrochloride.
| Compound Name | 3-[[4-[N-[4-(furan-2-yl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162334087 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[[4-[N-[4-(furan-2-yl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(/NC(=O)c1ccc(-c2ccco2)c(C)c1)c1ccc(CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H23N3O4.ClH/c1-15-13-18(8-9-19(15)20-3-2-12-30-20)23(29)26-22(24)17-6-4-16(5-7-17)14-25-11-10-21(27)28;/h2-9,12-13,25H,10-11,14H2,1H3,(H,27,28)(H2,24,26,29);1H |
| InChIKey | PRRJARNHVXUOHA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|