C26H24N4O3 — CID 143634105
3-[[4-[N'-[4-(4-cyanophenyl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid (PubChem CID 143634105) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[[4-[N'-[4-(4-cyanophenyl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[N'-[4-(4-cyanophenyl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 143634105 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[[4-[N'-[4-(4-cyanophenyl)-3-methylbenzoyl]carbamimidoyl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cc(C(=O)/N=C(\N)c2ccc(CNCCC(=O)O)cc2)ccc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H24N4O3/c1-17-14-22(10-11-23(17)20-6-2-18(15-27)3-7-20)26(33)30-25(28)21-8-4-19(5-9-21)16-29-13-12-24(31)32/h2-11,14,29H,12-13,16H2,1H3,(H,31,32)(H2,28,30,33) |
| InChIKey | PZXXIVYIRQUYQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|