C26H20ClN5O3 — CID 158315071
3-[[4-[5-[3-cyano-4-(2-cyanophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid;hydrochloride (PubChem CID 158315071) has the molecular formula C26H20ClN5O3 and a molecular weight of 485.93 g/mol. Its IUPAC name is 3-[[4-[5-[3-cyano-4-(2-cyanophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid;hydrochloride.
| Compound Name | 3-[[4-[5-[3-cyano-4-(2-cyanophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 158315071 |
| Molecular Formula | C26H20ClN5O3 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[[4-[5-[3-cyano-4-(2-cyanophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid;hydrochloride |
| SMILES | Cl.N#Cc1ccccc1-c1ccc(-c2nc(-c3ccc(CNCCC(=O)O)cc3)no2)cc1C#N |
| InChI | InChI=1S/C26H19N5O3.ClH/c27-14-20-3-1-2-4-22(20)23-10-9-19(13-21(23)15-28)26-30-25(31-34-26)18-7-5-17(6-8-18)16-29-12-11-24(32)33;/h1-10,13,29H,11-12,16H2,(H,32,33);1H |
| InChIKey | UCXUXGVPQJZEIE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|