C30H33N3O3 — CID 174704681
3-[[4-[5-[1,2-bis(3,5-dimethylphenyl)ethyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid (PubChem CID 174704681) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[[4-[5-[1,2-bis(3,5-dimethylphenyl)ethyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[1,2-bis(3,5-dimethylphenyl)ethyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 174704681 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[[4-[5-[1,2-bis(3,5-dimethylphenyl)ethyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cc(C)cc(CC(c2cc(C)cc(C)c2)c2nc(-c3ccc(CNCCC(=O)O)cc3)no2)c1 |
| InChI | InChI=1S/C30H33N3O3/c1-19-11-20(2)14-24(13-19)17-27(26-15-21(3)12-22(4)16-26)30-32-29(33-36-30)25-7-5-23(6-8-25)18-31-10-9-28(34)35/h5-8,11-16,27,31H,9-10,17-18H2,1-4H3,(H,34,35) |
| InChIKey | AOMWYXPIUANAOT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|