C27H27ClN4O3 — CID 174704712
3-[[4-[5-[(3-chlorophenyl)-(3,5-dimethylanilino)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid (PubChem CID 174704712) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is 3-[[4-[5-[(3-chlorophenyl)-(3,5-dimethylanilino)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[(3-chlorophenyl)-(3,5-dimethylanilino)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 174704712 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 3-[[4-[5-[(3-chlorophenyl)-(3,5-dimethylanilino)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cc(C)cc(NC(c2cccc(Cl)c2)c2nc(-c3ccc(CNCCC(=O)O)cc3)no2)c1 |
| InChI | InChI=1S/C27H27ClN4O3/c1-17-12-18(2)14-23(13-17)30-25(21-4-3-5-22(28)15-21)27-31-26(32-35-27)20-8-6-19(7-9-20)16-29-11-10-24(33)34/h3-9,12-15,25,29-30H,10-11,16H2,1-2H3,(H,33,34) |
| InChIKey | QKQPCQFGIUNKOU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|