C26H24FN3O3 — CID 59781724
3-[[4-[5-[3-ethyl-4-(2-fluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid (PubChem CID 59781724) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[[4-[5-[3-ethyl-4-(2-fluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[3-ethyl-4-(2-fluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 59781724 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-[[4-[5-[3-ethyl-4-(2-fluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
| SMILES | CCc1cc(-c2nc(-c3ccc(CNCCC(=O)O)cc3)no2)ccc1-c1ccccc1F |
| InChI | InChI=1S/C26H24FN3O3/c1-2-18-15-20(11-12-21(18)22-5-3-4-6-23(22)27)26-29-25(30-33-26)19-9-7-17(8-10-19)16-28-14-13-24(31)32/h3-12,15,28H,2,13-14,16H2,1H3,(H,31,32) |
| InChIKey | GMEDUQBPJRUBLO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|