C25H19FN4O3 — CID 59781702
3-[[4-[5-[4-(2-cyanophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid (PubChem CID 59781702) has the molecular formula C25H19FN4O3 and a molecular weight of 442.45 g/mol. Its IUPAC name is 3-[[4-[5-[4-(2-cyanophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[4-(2-cyanophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 59781702 |
| Molecular Formula | C25H19FN4O3 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[[4-[5-[4-(2-cyanophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propanoic acid |
| SMILES | N#Cc1ccccc1-c1ccc(-c2nc(-c3ccc(CNCCC(=O)O)cc3)no2)c(F)c1 |
| InChI | InChI=1S/C25H19FN4O3/c26-22-13-18(20-4-2-1-3-19(20)14-27)9-10-21(22)25-29-24(30-33-25)17-7-5-16(6-8-17)15-28-12-11-23(31)32/h1-10,13,28H,11-12,15H2,(H,31,32) |
| InChIKey | TZBIWVDXWKQOJP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|