C20H23N3O2 — CID 69099723
4-[2-[[4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenyl]methylamino]ethyl]phenol (PubChem CID 69099723) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[2-[[4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenyl]methylamino]ethyl]phenol.
| Compound Name | 4-[2-[[4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenyl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 69099723 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[2-[[4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenyl]methylamino]ethyl]phenol |
| SMILES | CC(C)c1nc(-c2ccc(CNCCc3ccc(O)cc3)cc2)no1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(2)20-22-19(23-25-20)17-7-3-16(4-8-17)13-21-12-11-15-5-9-18(24)10-6-15/h3-10,14,21,24H,11-13H2,1-2H3 |
| InChIKey | WAVDIZGWMZZWOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|