C15H15N3O4 — CID 90145948
3-[[5-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-2-yl]methylamino]propanoic acid (PubChem CID 90145948) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-[[5-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-2-yl]methylamino]propanoic acid.
| Compound Name | 3-[[5-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-2-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 90145948 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-[[5-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-2-yl]methylamino]propanoic acid |
| SMILES | Cc1nc(-c2ccc3oc(CNCCC(=O)O)cc3c2)no1 |
| InChI | InChI=1S/C15H15N3O4/c1-9-17-15(18-22-9)10-2-3-13-11(6-10)7-12(21-13)8-16-5-4-14(19)20/h2-3,6-7,16H,4-5,8H2,1H3,(H,19,20) |
| InChIKey | QRPXXRGMTZQJLZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|