C14H17N3O2 — CID 143877601
N-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]butanamide (PubChem CID 143877601) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]butanamide.
| Compound Name | N-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 143877601 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1ccc(-c2noc(C)n2)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-13(18)15-9-11-5-7-12(8-6-11)14-16-10(2)19-17-14/h5-8H,3-4,9H2,1-2H3,(H,15,18) |
| InChIKey | UYDMCZZNAGEKBT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |