About amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid
amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid (PubChem CID 69491439) has the molecular formula C11H12N4O3
and a molecular weight of 248.24 g/mol. Its IUPAC name is amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid.
Molecular Properties
| Compound Name | amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid |
| PubChem CID | 69491439 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid |
| SMILES | Cc1nc(-c2ccc(CN(N)C(=O)O)cc2)no1 |
| InChI | InChI=1S/C11H12N4O3/c1-7-13-10(14-18-7)9-4-2-8(3-5-9)6-15(12)11(16)17/h2-5H,6,12H2,1H3,(H,16,17) |
| InChIKey | XSNYRGACHPJIFC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid?
The IUPAC name of amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid (CID 69491439) is amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid.
What is the SMILES notation for amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid?
The canonical SMILES for amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid is Cc1nc(-c2ccc(CN(N)C(=O)O)cc2)no1.
What is the InChIKey of amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid?
The InChIKey is XSNYRGACHPJIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3/c1-7-13-10(14-18-7)9-4-2-8(3-5-9)6-15(12)11(16)17/h2-5H,6,12H2,1H3,(H,16,17).
What are the key properties of amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid?
amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid has a molecular weight of 248.24 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]carbamic acid is sourced from PubChem (CID 69491439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).