C50H93O12P — CID 140528196
[(2R)-1-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R)-1,3,4,5-tetrahydroxypentan-2-yl]oxyphosphoryl]oxypropan-2-yl] (6Z,18Z)-hexacosa-6,18-dienoate (PubChem CID 140528196) has the molecular formula C50H93O12P and a molecular weight of 917.26 g/mol. Its IUPAC name is [(2R)-1-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R)-1,3,4,5-tetrahydroxypentan-2-yl]oxyphosphoryl]oxypropan-2-yl] (6Z,18Z)-hexacosa-6,18-dienoate.
| Compound Name | [(2R)-1-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R)-1,3,4,5-tetrahydroxypentan-2-yl]oxyphosphoryl]oxypropan-2-yl] (6Z,18Z)-hexacosa-6,18-dienoate |
|---|---|
| PubChem CID | 140528196 |
| Molecular Formula | C50H93O12P |
| Molecular Weight | 917.26 g/mol |
| Exact Mass | 916.64 |
| IUPAC Name | [(2R)-1-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R)-1,3,4,5-tetrahydroxypentan-2-yl]oxyphosphoryl]oxypropan-2-yl] (6Z,18Z)-hexacosa-6,18-dienoate |
| SMILES | CCCCCCC/C=C\CCCCCCCCCC/C=C\CCCCC(=O)O[C@H](COC(=O)CCCC/C=C\CCCCCCCCC)COP(=O)(O)O[C@H](CO)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C50H93O12P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-28-30-32-34-36-38-40-49(55)61-45(44-60-63(57,58)62-47(42-52)50(56)46(53)41-51)43-59-48(54)39-37-35-33-31-29-27-16-14-12-10-8-6-4-2/h15,17,29-32,45-47,50-53,56H,3-14,16,18-28,33-44H2,1-2H3,(H,57,58)/b17-15-,31-29-,32-30-/t45-,46-,47-,50+/m1/s1 |
| InChIKey | VGDMALLSIHIVGD-HRABRBNDSA-N |
| XLogP | 11.84 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.26 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|