C51H95O13P — CID 139919915
[(2R)-1-deuterio-2-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]oxyphosphoryl]oxypropyl] (6Z,18Z)-hexacosa-6,18-dienoate (PubChem CID 139919915) has the molecular formula C51H95O13P and a molecular weight of 948.29 g/mol. Its IUPAC name is [(2R)-1-deuterio-2-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]oxyphosphoryl]oxypropyl] (6Z,18Z)-hexacosa-6,18-dienoate.
| Compound Name | [(2R)-1-deuterio-2-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]oxyphosphoryl]oxypropyl] (6Z,18Z)-hexacosa-6,18-dienoate |
|---|---|
| PubChem CID | 139919915 |
| Molecular Formula | C51H95O13P |
| Molecular Weight | 948.29 g/mol |
| Exact Mass | 947.66 |
| IUPAC Name | [(2R)-1-deuterio-2-[(Z)-hexadec-6-enoyl]oxy-3-[hydroxy-[(2R,3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl]oxyphosphoryl]oxypropyl] (6Z,18Z)-hexacosa-6,18-dienoate |
| SMILES | [2H]C(OC(=O)CCCC/C=C\CCCCCCCCCC/C=C\CCCCCCC)[C@H](COP(=O)(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO)OC(=O)CCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C51H95O13P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-28-29-31-33-35-37-39-48(55)61-43-45(44-62-65(59,60)64-47(42-53)51(58)50(57)46(54)41-52)63-49(56)40-38-36-34-32-30-27-16-14-12-10-8-6-4-2/h15,17,29-32,45-47,50-54,57-58H,3-14,16,18-28,33-44H2,1-2H3,(H,59,60)/b17-15-,31-29-,32-30-/t45-,46-,47-,50-,51-/m1/s1/i43D/t43?,45-,46-,47-,50-,51- |
| InChIKey | RQYNKSXHKHTOGQ-DLALUTKPSA-N |
| XLogP | 11.20 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.29 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|