C18H24N2O3S — CID 140528390
tert-butyl 2-[1-(2-amino-2-sulfanylideneethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-5-yl]acetate (PubChem CID 140528390) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-amino-2-sulfanylideneethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-5-yl]acetate.
| Compound Name | tert-butyl 2-[1-(2-amino-2-sulfanylideneethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-5-yl]acetate |
|---|---|
| PubChem CID | 140528390 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | tert-butyl 2-[1-(2-amino-2-sulfanylideneethyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-5-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCC(=O)N(CC(N)=S)c2ccccc21 |
| InChI | InChI=1S/C18H24N2O3S/c1-18(2,3)23-17(22)10-12-8-9-16(21)20(11-15(19)24)14-7-5-4-6-13(12)14/h4-7,12H,8-11H2,1-3H3,(H2,19,24) |
| InChIKey | UJEKBKIVMVMKKZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|