C55H56Zr — CID 140528743
cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-diphenyl-1,9-dihydrofluoren-1-ide;1,5-diphenylpentan-3-ylidenezirconium(2+) (PubChem CID 140528743) has the molecular formula C55H56Zr and a molecular weight of 808.28 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-diphenyl-1,9-dihydrofluoren-1-ide;1,5-diphenylpentan-3-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-diphenyl-1,9-dihydrofluoren-1-ide;1,5-diphenylpentan-3-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 140528743 |
| Molecular Formula | C55H56Zr |
| Molecular Weight | 808.28 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-diphenyl-1,9-dihydrofluoren-1-ide;1,5-diphenylpentan-3-ylidenezirconium(2+) |
| SMILES | CC(C)(C)c1cc2c([c-]c1-c1ccccc1)Cc1cc(-c3ccccc3)c(C(C)(C)C)cc1-2.[C-]1=CC=CC1.[Zr+2]=C(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C33H33.C17H18.C5H5.Zr/c1-32(2,3)30-20-26-24(18-28(30)22-13-9-7-10-14-22)17-25-19-29(23-15-11-8-12-16-23)31(21-27(25)26)33(4,5)6;1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;1-2-4-5-3-1;/h7-16,18,20-21H,17H2,1-6H3;1-2,4-7,10-13H,8-9,14-15H2;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | JUXBIUCOCMPTPZ-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.28 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|