C43H64Zr — CID 140528866
cyclopenta-1,3-diene;nonan-5-ylidenezirconium(2+);2,3,6,7-tetratert-butyl-1,9-dihydrofluoren-1-ide (PubChem CID 140528866) has the molecular formula C43H64Zr and a molecular weight of 672.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;nonan-5-ylidenezirconium(2+);2,3,6,7-tetratert-butyl-1,9-dihydrofluoren-1-ide.
| Compound Name | cyclopenta-1,3-diene;nonan-5-ylidenezirconium(2+);2,3,6,7-tetratert-butyl-1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 140528866 |
| Molecular Formula | C43H64Zr |
| Molecular Weight | 672.21 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | cyclopenta-1,3-diene;nonan-5-ylidenezirconium(2+);2,3,6,7-tetratert-butyl-1,9-dihydrofluoren-1-ide |
| SMILES | CC(C)(C)c1[c-]c2c(cc1C(C)(C)C)-c1cc(C(C)(C)C)c(C(C)(C)C)cc1C2.CCCCC(=[Zr+2])CCCC.[C-]1=CC=CC1 |
| InChI | InChI=1S/C29H41.C9H18.C5H5.Zr/c1-26(2,3)22-14-18-13-19-15-23(27(4,5)6)25(29(10,11)12)17-21(19)20(18)16-24(22)28(7,8)9;1-3-5-7-9-8-6-4-2;1-2-4-5-3-1;/h14,16-17H,13H2,1-12H3;3-8H2,1-2H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | XVFBYSDIXRUVDR-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.21 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|