C37H52Zr — CID 140528783
cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;2,6-dimethylheptan-4-ylidenezirconium(2+) (PubChem CID 140528783) has the molecular formula C37H52Zr and a molecular weight of 588.05 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;2,6-dimethylheptan-4-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;2,6-dimethylheptan-4-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 140528783 |
| Molecular Formula | C37H52Zr |
| Molecular Weight | 588.05 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;2,6-dimethylheptan-4-ylidenezirconium(2+) |
| SMILES | CC(C)CC(=[Zr+2])CC(C)C.Cc1[c-]c2c(cc1C(C)(C)C)-c1cc(C(C)(C)C)c(C)cc1C2.[C-]1=CC=CC1 |
| InChI | InChI=1S/C23H29.C9H18.C5H5.Zr/c1-14-9-16-11-17-10-15(2)21(23(6,7)8)13-19(17)18(16)12-20(14)22(3,4)5;1-8(2)6-5-7-9(3)4;1-2-4-5-3-1;/h9,12-13H,11H2,1-8H3;8-9H,6-7H2,1-4H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | QRTFZJZICYUROP-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.05 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|