C23H29Cl2Zr- — CID 173029604
3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;dichlorozirconium (PubChem CID 173029604) has the molecular formula C23H29Cl2Zr- and a molecular weight of 467.62 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;dichlorozirconium.
| Compound Name | 3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;dichlorozirconium |
|---|---|
| PubChem CID | 173029604 |
| Molecular Formula | C23H29Cl2Zr- |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 3,6-ditert-butyl-2,7-dimethyl-1,9-dihydrofluoren-1-ide;dichlorozirconium |
| SMILES | Cc1[c-]c2c(cc1C(C)(C)C)-c1cc(C(C)(C)C)c(C)cc1C2.Cl[Zr]Cl |
| InChI | InChI=1S/C23H29.2ClH.Zr/c1-14-9-16-11-17-10-15(2)21(23(6,7)8)13-19(17)18(16)12-20(14)22(3,4)5;;;/h9,12-13H,11H2,1-8H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | NUJZRZVAHFVSAN-UHFFFAOYSA-L |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|