C13H24O14S — CID 140529530
[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl] methanesulfonate (PubChem CID 140529530) has the molecular formula C13H24O14S and a molecular weight of 436.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl] methanesulfonate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 140529530 |
| Molecular Formula | C13H24O14S |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@]1(CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O14S/c1-28(22,23)27-13(3-15)10(20)6(17)8(19)12(26-13)25-9-4(2-14)24-11(21)7(18)5(9)16/h4-12,14-21H,2-3H2,1H3/t4-,5-,6+,7-,8-,9-,10-,11-,12+,13-/m1/s1 |
| InChIKey | DXZATNFSVKYFQO-JRYHDCMASA-N |
| XLogP | -6.09 |
| TPSA | 232.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | -6.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|