C13H20O12 — CID 22882898
(4R,6R,7R,8S,9R)-7,8,9-trihydroxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2,5-dioxaspiro[3.5]nonan-3-one (PubChem CID 22882898) has the molecular formula C13H20O12 and a molecular weight of 368.29 g/mol. Its IUPAC name is (4R,6R,7R,8S,9R)-7,8,9-trihydroxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2,5-dioxaspiro[3.5]nonan-3-one.
| Compound Name | (4R,6R,7R,8S,9R)-7,8,9-trihydroxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2,5-dioxaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 22882898 |
| Molecular Formula | C13H20O12 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (4R,6R,7R,8S,9R)-7,8,9-trihydroxy-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2,5-dioxaspiro[3.5]nonan-3-one |
| SMILES | O=C1OC[C@]12O[C@@H](O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]1CO)[C@H](O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C13H20O12/c14-1-3-8(4(15)6(17)10(20)23-3)24-11-7(18)5(16)9(19)13(25-11)2-22-12(13)21/h3-11,14-20H,1-2H2/t3-,4-,5-,6-,7-,8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | ZYBVLRFMFPCTPB-PKTWHRPDSA-N |
| XLogP | -5.46 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|