C27H60O4Si3 — CID 140529968
(4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanal (PubChem CID 140529968) has the molecular formula C27H60O4Si3 and a molecular weight of 533.03 g/mol. Its IUPAC name is (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanal.
| Compound Name | (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanal |
|---|---|
| PubChem CID | 140529968 |
| Molecular Formula | C27H60O4Si3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanal |
| SMILES | CC[Si](CC)(CC)OC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCC=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H60O4Si3/c1-13-32(14-2,15-3)29-22-27(31-34(23(7)8,24(9)10)25(11)12)26(20-19-21-28)30-33(16-4,17-5)18-6/h21,23-27H,13-20,22H2,1-12H3/t26-,27+/m0/s1 |
| InChIKey | FTGAMYWEKNMEDC-RRPNLBNLSA-N |
| XLogP | 8.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|