C16H20N2O6 — CID 140529985
diethyl 2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioate (PubChem CID 140529985) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is diethyl 2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 140529985 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | diethyl 2-[[(2-nitro-1-phenylethyl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNC(C[N+](=O)[O-])c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O6/c1-3-23-15(19)13(16(20)24-4-2)10-17-14(11-18(21)22)12-8-6-5-7-9-12/h5-10,14,17H,3-4,11H2,1-2H3 |
| InChIKey | RVJYFCDBHHFTJZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|