C16H16BrCl2F5N6O2S2 — CID 140530540
N'-[4-[2-bromoethyl(methylsulfonyl)amino]-3-cyano-1-[2,6-dichloro-4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 140530540) has the molecular formula C16H16BrCl2F5N6O2S2 and a molecular weight of 634.28 g/mol. Its IUPAC name is N'-[4-[2-bromoethyl(methylsulfonyl)amino]-3-cyano-1-[2,6-dichloro-4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[2-bromoethyl(methylsulfonyl)amino]-3-cyano-1-[2,6-dichloro-4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 140530540 |
| Molecular Formula | C16H16BrCl2F5N6O2S2 |
| Molecular Weight | 634.28 g/mol |
| Exact Mass | 631.93 |
| IUPAC Name | N'-[4-[2-bromoethyl(methylsulfonyl)amino]-3-cyano-1-[2,6-dichloro-4-(pentafluoro-λ6-sulfanyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1c(N(CCBr)S(C)(=O)=O)c(C#N)nn1-c1c(Cl)cc(S(F)(F)(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H16BrCl2F5N6O2S2/c1-28(2)9-26-16-15(29(5-4-17)33(3,31)32)13(8-25)27-30(16)14-11(18)6-10(7-12(14)19)34(20,21,22,23)24/h6-7,9H,4-5H2,1-3H3/b26-9+ |
| InChIKey | HXFAZOZOORBFJP-JQAMDZJQSA-N |
| XLogP | 6.09 |
| TPSA | 94.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.28 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|