C18H31NOSi — CID 140530648
(1S)-1-cyclopropyl-4-methyl-1-phenyl-2-trimethylsilyloxypentan-3-amine (PubChem CID 140530648) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is (1S)-1-cyclopropyl-4-methyl-1-phenyl-2-trimethylsilyloxypentan-3-amine.
| Compound Name | (1S)-1-cyclopropyl-4-methyl-1-phenyl-2-trimethylsilyloxypentan-3-amine |
|---|---|
| PubChem CID | 140530648 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (1S)-1-cyclopropyl-4-methyl-1-phenyl-2-trimethylsilyloxypentan-3-amine |
| SMILES | CC(C)C(N)C(O[Si](C)(C)C)[C@H](c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H31NOSi/c1-13(2)17(19)18(20-21(3,4)5)16(15-11-12-15)14-9-7-6-8-10-14/h6-10,13,15-18H,11-12,19H2,1-5H3/t16-,17?,18?/m1/s1 |
| InChIKey | ADJZUNHSRFAHST-WWDZGPRUSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|