C17H23NO — CID 140532715
5-methoxy-3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindole (PubChem CID 140532715) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-methoxy-3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindole.
| Compound Name | 5-methoxy-3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 140532715 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 5-methoxy-3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindole |
| SMILES | COC1CCC2N=C(c3ccccc3)C(C)(C)C2C1 |
| InChI | InChI=1S/C17H23NO/c1-17(2)14-11-13(19-3)9-10-15(14)18-16(17)12-7-5-4-6-8-12/h4-8,13-15H,9-11H2,1-3H3 |
| InChIKey | GAAJPLSPBWIZPY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |