C16H21NO — CID 140532718
3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindol-5-ol (PubChem CID 140532718) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindol-5-ol.
| Compound Name | 3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindol-5-ol |
|---|---|
| PubChem CID | 140532718 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3,3-dimethyl-2-phenyl-3a,4,5,6,7,7a-hexahydroindol-5-ol |
| SMILES | CC1(C)C(c2ccccc2)=NC2CCC(O)CC21 |
| InChI | InChI=1S/C16H21NO/c1-16(2)13-10-12(18)8-9-14(13)17-15(16)11-6-4-3-5-7-11/h3-7,12-14,18H,8-10H2,1-2H3 |
| InChIKey | MMPKSUAGXZNLEV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |