C13H16ClNO — CID 141121509
1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride (PubChem CID 141121509) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride.
| Compound Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 141121509 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride |
| SMILES | Cl.OC1CCC2N=Cc3ccccc3C2C1 |
| InChI | InChI=1S/C13H15NO.ClH/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;/h1-4,8,10,12-13,15H,5-7H2;1H |
| InChIKey | SNAXIDFAKQNONF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |