C30H56O6 — CID 140533255
[3,3-dimethyl-2,2-di(octanoyloxy)butyl] octanoate (PubChem CID 140533255) has the molecular formula C30H56O6 and a molecular weight of 512.77 g/mol. Its IUPAC name is [3,3-dimethyl-2,2-di(octanoyloxy)butyl] octanoate.
| Compound Name | [3,3-dimethyl-2,2-di(octanoyloxy)butyl] octanoate |
|---|---|
| PubChem CID | 140533255 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | [3,3-dimethyl-2,2-di(octanoyloxy)butyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(OC(=O)CCCCCCC)(OC(=O)CCCCCCC)C(C)(C)C |
| InChI | InChI=1S/C30H56O6/c1-7-10-13-16-19-22-26(31)34-25-30(29(4,5)6,35-27(32)23-20-17-14-11-8-2)36-28(33)24-21-18-15-12-9-3/h7-25H2,1-6H3 |
| InChIKey | XCJKEDCBIPFSQH-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|