C19H29N3O4 — CID 140534526
2-[[4-[(1,2-dimethyl-3,5-dioxopyrazolidin-4-ylidene)methyl]cyclohexyl]-ethylamino]ethyl prop-2-enoate (PubChem CID 140534526) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[4-[(1,2-dimethyl-3,5-dioxopyrazolidin-4-ylidene)methyl]cyclohexyl]-ethylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[4-[(1,2-dimethyl-3,5-dioxopyrazolidin-4-ylidene)methyl]cyclohexyl]-ethylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140534526 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[[4-[(1,2-dimethyl-3,5-dioxopyrazolidin-4-ylidene)methyl]cyclohexyl]-ethylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CC)C1CCC(C=C2C(=O)N(C)N(C)C2=O)CC1 |
| InChI | InChI=1S/C19H29N3O4/c1-5-17(23)26-12-11-22(6-2)15-9-7-14(8-10-15)13-16-18(24)20(3)21(4)19(16)25/h5,13-15H,1,6-12H2,2-4H3 |
| InChIKey | MLTJYPYPXRMMIX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|