C19H15ClN2O — CID 140537308
2-(2-methoxyphenyl)-1,10-phenanthroline;hydrochloride (PubChem CID 140537308) has the molecular formula C19H15ClN2O and a molecular weight of 322.80 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,10-phenanthroline;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1,10-phenanthroline;hydrochloride |
|---|---|
| PubChem CID | 140537308 |
| Molecular Formula | C19H15ClN2O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,10-phenanthroline;hydrochloride |
| SMILES | COc1ccccc1-c1ccc2ccc3cccnc3c2n1.Cl |
| InChI | InChI=1S/C19H14N2O.ClH/c1-22-17-7-3-2-6-15(17)16-11-10-14-9-8-13-5-4-12-20-18(13)19(14)21-16;/h2-12H,1H3;1H |
| InChIKey | QYFFZCJJIGFACI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|